Information card for entry 2238601
| Chemical name |
1-(3,5-Dimethoxyphenyl)-4,5-dimethyl-2-phenyl-1<i>H</i>-imidazole |
| Formula |
C19 H20 N2 O2 |
| Calculated formula |
C19 H20 N2 O2 |
| SMILES |
COc1cc(OC)cc(c1)n1c(nc(c1C)C)c1ccccc1 |
| Title of publication |
1-(3,5-Dimethoxyphenyl)-4,5-dimethyl-2-phenyl-1<i>H</i>-imidazole |
| Authors of publication |
Divya, G.; Saravanan, K.; Santhiya, S.; Chandralekha, K.; Lakshmi, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
10 |
| Pages of publication |
o1502 |
| a |
8.363 ± 0.005 Å |
| b |
10.267 ± 0.005 Å |
| c |
10.481 ± 0.005 Å |
| α |
75.043 ± 0.005° |
| β |
75.789 ± 0.005° |
| γ |
74.576 ± 0.005° |
| Cell volume |
822.9 ± 0.7 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0538 |
| Residual factor for significantly intense reflections |
0.0416 |
| Weighted residual factors for significantly intense reflections |
0.1152 |
| Weighted residual factors for all reflections included in the refinement |
0.1262 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238601.html