Information card for entry 2238824
| Chemical name |
(2,2'-Bipyridine-κ^2^<i>N</i>,<i>N</i>')bis(nitrato-κ^2^<i>O</i>,<i>O</i>')copper(II) |
| Formula |
C10 H8 Cu N4 O6 |
| Calculated formula |
C10 H8 Cu N4 O6 |
| SMILES |
[Cu]123([n]4ccccc4c4[n]1cccc4)(ON(=[O]2)=O)[O]=N(=O)O3 |
| Title of publication |
(2,2'-Bipyridine-κ^2^<i>N</i>,<i>N</i>')bis(nitrato-κ^2^<i>O</i>,<i>O</i>')copper(II) |
| Authors of publication |
Liu, Feng-Yi; Zhang, Ming-Hui; Kou, Jun-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
11 |
| Pages of publication |
m609 |
| a |
8.4282 ± 0.0017 Å |
| b |
11.132 ± 0.002 Å |
| c |
16.14 ± 0.005 Å |
| α |
90° |
| β |
121.39 ± 0.02° |
| γ |
90° |
| Cell volume |
1292.7 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0509 |
| Residual factor for significantly intense reflections |
0.0353 |
| Weighted residual factors for significantly intense reflections |
0.0888 |
| Weighted residual factors for all reflections included in the refinement |
0.0983 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238824.html