Information card for entry 2238967
| Chemical name |
2,3-Bis{[2,3-dimethyl-6-(phenylvinyl)phenyl]imino}butane |
| Formula |
C36 H36 N2 |
| Calculated formula |
C36 H36 N2 |
| SMILES |
CC(=N\c1c(C)c(C)ccc1C(=C)c1ccccc1)/C(=N/c1c(C)c(C)ccc1C(=C)c1ccccc1)C |
| Title of publication |
2,3-Bis{[2,3-dimethyl-6-(phenylvinyl)phenyl]imino}butane |
| Authors of publication |
Zhao, Jie; Yuan, Jianchao; Xu, Weibing; Chen, Jingjing; Mu, Yanqiong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o130 |
| a |
9.613 ± 0.008 Å |
| b |
16.285 ± 0.014 Å |
| c |
9.639 ± 0.008 Å |
| α |
90° |
| β |
101.679 ± 0.009° |
| γ |
90° |
| Cell volume |
1478 ± 2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.178 |
| Residual factor for significantly intense reflections |
0.1034 |
| Weighted residual factors for significantly intense reflections |
0.2668 |
| Weighted residual factors for all reflections included in the refinement |
0.3266 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238967.html