Information card for entry 2239034
| Chemical name |
2,3-Diphenyl-2,3,5,6-tetrahydro-4<i>H</i>-1,3-thiazin-4-one |
| Formula |
C16 H15 N O S |
| Calculated formula |
C16 H15 N O S |
| SMILES |
C1(=O)CCSC(c2ccccc2)N1c1ccccc1 |
| Title of publication |
2,3-Diphenyl-2,3,5,6-tetrahydro-4<i>H</i>-1,3-thiazin-4-one |
| Authors of publication |
Yennawar, Hemant P.; Silverberg, Lee J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o133 |
| a |
13.745 ± 0.003 Å |
| b |
8.24 ± 0.002 Å |
| c |
12.151 ± 0.003 Å |
| α |
90° |
| β |
100.079 ± 0.006° |
| γ |
90° |
| Cell volume |
1355 ± 0.6 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0831 |
| Residual factor for significantly intense reflections |
0.0608 |
| Weighted residual factors for significantly intense reflections |
0.1299 |
| Weighted residual factors for all reflections included in the refinement |
0.1396 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.127 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239034.html