Information card for entry 2239041
| Chemical name |
(<i>E</i>)-4-Methoxy-<i>N</i>'-(2,4,5-trimethoxybenzylidene)benzohydrazide hemihydrate |
| Formula |
C18 H21 N2 O5.5 |
| Calculated formula |
C18 H21 N2 O5.5 |
| SMILES |
COc1ccc(cc1)C(=O)N/N=C/c1cc(OC)c(cc1OC)OC.O |
| Title of publication |
(<i>E</i>)-4-Methoxy-<i>N</i>'-(2,4,5-trimethoxybenzylidene)benzohydrazide hemihydrate |
| Authors of publication |
Chantrapromma, Suchada; Boonnak, Nawong; Horkaew, Jirapa; Quah, Ching Kheng; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o150 - o151 |
| a |
13.4405 ± 0.0003 Å |
| b |
16.9172 ± 0.0003 Å |
| c |
7.6841 ± 0.0002 Å |
| α |
90° |
| β |
96.084 ± 0.001° |
| γ |
90° |
| Cell volume |
1737.34 ± 0.07 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1035 |
| Residual factor for significantly intense reflections |
0.0591 |
| Weighted residual factors for significantly intense reflections |
0.1192 |
| Weighted residual factors for all reflections included in the refinement |
0.1378 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239041.html