Information card for entry 2239049
| Chemical name |
4-[(1-Benzyl-1<i>H</i>-1,2,3-triazol-4-yl)methyl]-2<i>H</i>-1,4-benzothiazin-3(4<i>H</i>)-one |
| Formula |
C18 H16 N4 O S |
| Calculated formula |
C18 H16 N4 O S |
| SMILES |
O=C1CSc2c(N1Cc1nnn(c1)Cc1ccccc1)cccc2 |
| Title of publication |
4-[(1-Benzyl-1<i>H</i>-1,2,3-triazol-4-yl)methyl]-2<i>H</i>-1,4-benzothiazin-3(4<i>H</i>)-one |
| Authors of publication |
Sebbar, Nada Kheira; Zerzouf, Abdelfettah; Essassi, El Mokhtar; Saadi, Mohamed; El Ammari, Lahcen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o160 - o161 |
| a |
13.283 ± 0.002 Å |
| b |
5.3661 ± 0.001 Å |
| c |
23.281 ± 0.004 Å |
| α |
90° |
| β |
96.633 ± 0.01° |
| γ |
90° |
| Cell volume |
1648.3 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0664 |
| Residual factor for significantly intense reflections |
0.0459 |
| Weighted residual factors for significantly intense reflections |
0.1334 |
| Weighted residual factors for all reflections included in the refinement |
0.1492 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239049.html