Information card for entry 2239060
| Chemical name |
(<i>Z</i>)-<i>N</i>-[(<i>Z</i>)-3-(2,5-Dimethylphenylimino)butan-2-ylidene]-2,5-dimethylaniline |
| Formula |
C20 H24 N2 |
| Calculated formula |
C20 H24 N2 |
| SMILES |
CC(=N\c1cc(C)ccc1C)/C(=N/c1cc(C)ccc1C)C |
| Title of publication |
(<i>Z</i>)-<i>N</i>-[(<i>Z</i>)-3-(2,5-Dimethylphenylimino)butan-2-ylidene]-2,5-dimethylaniline |
| Authors of publication |
Lv, Wen-Xian; Li, Jian; Hu, Yu-Lai; Su, Ying-Peng; Huang, Dan-Feng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o175 |
| a |
7.128 ± 0.003 Å |
| b |
8.304 ± 0.004 Å |
| c |
15.162 ± 0.007 Å |
| α |
90° |
| β |
96.528 ± 0.005° |
| γ |
90° |
| Cell volume |
891.6 ± 0.7 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0782 |
| Residual factor for significantly intense reflections |
0.0511 |
| Weighted residual factors for significantly intense reflections |
0.1513 |
| Weighted residual factors for all reflections included in the refinement |
0.1749 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239060.html