Information card for entry 2239069
| Chemical name |
Ethyl 6-(4-cyclopropyl-1<i>H</i>-1,2,3-triazol-1-yl)pyridine-3-carboxylate |
| Formula |
C13 H14 N4 O2 |
| Calculated formula |
C13 H14 N4 O2 |
| SMILES |
CCOC(=O)c1ccc(nc1)n1nnc(c1)C1CC1 |
| Title of publication |
Ethyl 6-(4-cyclopropyl-1<i>H</i>-1,2,3-triazol-1-yl)pyridine-3-carboxylate |
| Authors of publication |
Ahmed, Muhammad Naeem; Yasin, Khawaja Ansar; Tahir, M. Nawaz; Bibi, Asma; Andleeb, Hina |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o136 |
| a |
7.1565 ± 0.0006 Å |
| b |
9.3521 ± 0.0008 Å |
| c |
9.8747 ± 0.0009 Å |
| α |
85.722 ± 0.004° |
| β |
81.422 ± 0.004° |
| γ |
86.941 ± 0.004° |
| Cell volume |
651.09 ± 0.1 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.069 |
| Residual factor for significantly intense reflections |
0.046 |
| Weighted residual factors for significantly intense reflections |
0.1176 |
| Weighted residual factors for all reflections included in the refinement |
0.1369 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239069.html