Information card for entry 2239173
| Chemical name |
2-{<i>N</i>-[(2,3,4,9-Tetrahydro-1<i>H</i>-carbazol-3-yl)methyl]methylsulfonamido}ethyl methanesulfonate |
| Formula |
C17 H24 N2 O5 S2 |
| Calculated formula |
C17 H24 N2 O5 S2 |
| SMILES |
S(=O)(=O)(N(CC1CCc2[nH]c3c(c2C1)cccc3)CCOS(=O)(=O)C)C |
| Title of publication |
2-{<i>N</i>-[(2,3,4,9-Tetrahydro-1<i>H</i>-carbazol-3-yl)methyl]methylsulfonamido}ethyl methanesulfonate |
| Authors of publication |
Göçmentürk, Mustafa; Ergün, Yavuz; Mougang-Soume, Berline; Çaylak Delibaş, Nagihan; Hökelek, Tuncer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
1 |
| Pages of publication |
o78 - o79 |
| a |
5.4399 ± 0.0002 Å |
| b |
18.0322 ± 0.0006 Å |
| c |
19.0103 ± 0.0006 Å |
| α |
90° |
| β |
98.973 ± 0.002° |
| γ |
90° |
| Cell volume |
1841.96 ± 0.11 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0321 |
| Residual factor for significantly intense reflections |
0.0313 |
| Weighted residual factors for significantly intense reflections |
0.0888 |
| Weighted residual factors for all reflections included in the refinement |
0.0897 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239173.html