Information card for entry 2239183
| Common name |
(4-Methylpiperazin-1-yl)-(2,3,4-trimethoxybenzylidene)amine |
| Chemical name |
(4-Methylpiperazin-1-yl)(2,3,4-trimethoxybenzylidene)amine |
| Formula |
C15 H23 N3 O3 |
| Calculated formula |
C15 H23 N3 O3 |
| SMILES |
COc1c(/C=N/N2CCN(CC2)C)ccc(c1OC)OC |
| Title of publication |
(4-Methylpiperazin-1-yl)(2,3,4-trimethoxybenzylidene)amine |
| Authors of publication |
Kavitha, Channappa N.; Jasinski, Jerry P.; Kaur, Manpreet; Yathirajan, H.S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
4 |
| Pages of publication |
o500 |
| a |
7.84207 ± 0.00014 Å |
| b |
14.2305 ± 0.0003 Å |
| c |
27.6218 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3082.5 ± 0.1 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0443 |
| Residual factor for significantly intense reflections |
0.0395 |
| Weighted residual factors for significantly intense reflections |
0.1089 |
| Weighted residual factors for all reflections included in the refinement |
0.1133 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239183.html