Information card for entry 2239191
| Chemical name |
4-Amino-<i>N</i>-(2,3-dihydro-1,3-thiazol-2-ylidene)benzenesulfonamide; 2,4,6-tris(pyridin-2-yl)-1,3,5-triazine |
| Formula |
C27 H21 N9 O2 S2 |
| Calculated formula |
C27 H21 N9 O2 S2 |
| SMILES |
S1C(NC=C1)=NS(=O)(=O)c1ccc(N)cc1.n1c(nc(nc1c1ncccc1)c1ncccc1)c1ncccc1 |
| Title of publication |
4-Amino-<i>N</i>-(2,3-dihydro-1,3-thiazol-2-ylidene)benzenesulfonamide–2,4,6-tris(pyridin-2-yl)-1,3,5-triazine (1/1) |
| Authors of publication |
Arman, Hadi D.; Kaulgud, Trupta; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
4 |
| Pages of publication |
o402 - o403 |
| a |
8.8109 ± 0.0013 Å |
| b |
12.7222 ± 0.0016 Å |
| c |
13.1696 ± 0.0014 Å |
| α |
66.227 ± 0.006° |
| β |
73.797 ± 0.006° |
| γ |
88.068 ± 0.009° |
| Cell volume |
1292.1 ± 0.3 Å3 |
| Cell temperature |
98 ± 2 K |
| Ambient diffraction temperature |
98 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0472 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.0847 |
| Weighted residual factors for all reflections included in the refinement |
0.0869 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.991 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239191.html