Information card for entry 2239220
| Chemical name |
(<i>Z</i>)-5-(3,4,5-Trimethoxystyryl)-2,3-dihydrothieno[3,4-<i>b</i>][1,4]dioxine |
| Formula |
C17 H18 O5 S |
| Calculated formula |
C17 H18 O5 S |
| SMILES |
COc1cc(/C=C\c2scc3c2OCCO3)cc(c1OC)OC |
| Title of publication |
(<i>Z</i>)-5-(3,4,5-Trimethoxystyryl)-2,3-dihydrothieno[3,4-<i>b</i>][1,4]dioxine |
| Authors of publication |
Liu, Yu-Tao; Chu, Gang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
4 |
| Pages of publication |
o384 |
| a |
8.197 ± 0.002 Å |
| b |
8.4527 ± 0.0015 Å |
| c |
11.835 ± 0.003 Å |
| α |
88.774 ± 0.001° |
| β |
85.484 ± 0.003° |
| γ |
76.422 ± 0.002° |
| Cell volume |
794.6 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0696 |
| Residual factor for significantly intense reflections |
0.0658 |
| Weighted residual factors for significantly intense reflections |
0.1743 |
| Weighted residual factors for all reflections included in the refinement |
0.1794 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.988 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239220.html