Information card for entry 2239229
| Chemical name |
(1<i>S</i>,3<i>S</i>,8<i>R</i>,9<i>S</i>,10<i>R</i>)-9,10-Epoxy-3,7,7,10-tetramethyltricyclo[6.4.0.0^1,3^]dodecane |
| Formula |
C16 H26 O |
| Calculated formula |
C16 H26 O |
| SMILES |
CC1(C)CCC[C@@]2([C@]3([C@@H]1[C@@H]1O[C@]1(C)CC3)C2)C |
| Title of publication |
(1<i>S</i>,3<i>S</i>,8<i>R</i>,9<i>S</i>,10<i>R</i>)-9,10-Epoxy-3,7,7,10-tetramethyltricyclo[6.4.0.0^1,3^]dodecane |
| Authors of publication |
Bimoussa, Abdoullah; Auhmani, Aziz; Ait Itto, My Youssef; Daran, Jean-Claude; Auhmani, Abdelwahed |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
4 |
| Pages of publication |
o480 |
| a |
10.5563 ± 0.001 Å |
| b |
5.7548 ± 0.0005 Å |
| c |
11.7096 ± 0.0013 Å |
| α |
90° |
| β |
92.777 ± 0.008° |
| γ |
90° |
| Cell volume |
710.52 ± 0.12 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.085 |
| Residual factor for significantly intense reflections |
0.054 |
| Weighted residual factors for significantly intense reflections |
0.0867 |
| Weighted residual factors for all reflections included in the refinement |
0.1049 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239229.html