Information card for entry 2239358
| Chemical name |
1-[(1-Benzyl-1<i>H</i>-1,2,3-triazol-4-yl)methyl]indoline-2,3-dione |
| Formula |
C18 H14 N4 O2 |
| Calculated formula |
C18 H14 N4 O2 |
| SMILES |
O=C1C(=O)c2c(N1Cc1nnn(c1)Cc1ccccc1)cccc2 |
| Title of publication |
1-[(1-Benzyl-1<i>H</i>-1,2,3-triazol-4-yl)methyl]indoline-2,3-dione |
| Authors of publication |
Qachchachi, Fatima-Zahrae; Kandri Rodi, Youssef; Essassi, El Mokhtar; Bodensteiner, Michael; El Ammari, Lahcen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
5 |
| Pages of publication |
o588 |
| a |
11.5386 ± 0.00018 Å |
| b |
5.387 ± 0.00009 Å |
| c |
23.2433 ± 0.0004 Å |
| α |
90° |
| β |
92.1048 ± 0.0016° |
| γ |
90° |
| Cell volume |
1443.79 ± 0.04 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0518 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.1179 |
| Weighted residual factors for all reflections included in the refinement |
0.1234 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239358.html