Information card for entry 2239490
| Chemical name |
3-Bromo-2-[4-(methylsulfanyl)phenyl]-5,6,7,8-tetrahydro-1,3-benzothiazolo[3,2-<i>a</i>]imidazole |
| Formula |
C16 H15 Br N2 S2 |
| Calculated formula |
C16 H15 Br N2 S2 |
| SMILES |
CSc1ccc(cc1)c1nc2n(c1Br)c1c(s2)CCCC1 |
| Title of publication |
3-Bromo-2-[4-(methylsulfanyl)phenyl]-5,6,7,8-tetrahydro-1,3-benzothiazolo[3,2-<i>a</i>]imidazole |
| Authors of publication |
Bunev, Alexander S.; Sukhonosova, Elena V.; Statsyuk, Vladimir E.; Ostapenko, Gennady I.; Khrustalev, Victor N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
5 |
| Pages of publication |
o596 - o597 |
| a |
7.3132 ± 0.0003 Å |
| b |
7.5663 ± 0.0003 Å |
| c |
14.4543 ± 0.0007 Å |
| α |
95.033 ± 0.001° |
| β |
97.188 ± 0.001° |
| γ |
101.938 ± 0.001° |
| Cell volume |
771.03 ± 0.06 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.037 |
| Residual factor for significantly intense reflections |
0.0301 |
| Weighted residual factors for significantly intense reflections |
0.0706 |
| Weighted residual factors for all reflections included in the refinement |
0.0725 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239490.html