Information card for entry 2239499
| Chemical name |
(1<i>E</i>,4<i>E</i>)-1,5-Bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one |
| Formula |
C25 H32 N2 O |
| Calculated formula |
C25 H32 N2 O |
| SMILES |
CCN(c1ccc(cc1)/C=C/C(=O)/C=C/c1ccc(cc1)N(CC)CC)CC |
| Title of publication |
(1<i>E</i>,4<i>E</i>)-1,5-Bis[4-(diethylamino)phenyl]penta-1,4-dien-3-one |
| Authors of publication |
Ruanwas, Pumsak; Chantrapromma, Suchada; Ghabbour, Hazem A.; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
5 |
| Pages of publication |
o589 - o590 |
| a |
10.429 ± 0.0004 Å |
| b |
40.4773 ± 0.0016 Å |
| c |
10.8087 ± 0.0005 Å |
| α |
90° |
| β |
100.262 ± 0.0013° |
| γ |
90° |
| Cell volume |
4489.8 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1439 |
| Residual factor for significantly intense reflections |
0.0833 |
| Weighted residual factors for significantly intense reflections |
0.2237 |
| Weighted residual factors for all reflections included in the refinement |
0.2695 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239499.html