Information card for entry 2239532
| Chemical name |
<i>N</i>-(1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1<i>H</i>-pyrazol-4-yl)-2-(4-nitrophenyl)acetamide |
| Formula |
C19 H18 N4 O4 |
| Calculated formula |
C19 H18 N4 O4 |
| SMILES |
O=C(Nc1c(n(n(c1=O)c1ccccc1)C)C)Cc1ccc(N(=O)=O)cc1 |
| Title of publication |
<i>N</i>-(1,5-Dimethyl-3-oxo-2-phenyl-2,3-dihydro-1<i>H</i>-pyrazol-4-yl)-2-(4-nitrophenyl)acetamide |
| Authors of publication |
Kaur, Manpreet; Jasinski, Jerry P.; Yathirajan, H. S.; Narayana, B.; Byrappa, K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
6 |
| Pages of publication |
o636 - o637 |
| a |
6.7023 ± 0.0006 Å |
| b |
8.6335 ± 0.0008 Å |
| c |
15.872 ± 0.0013 Å |
| α |
76.305 ± 0.007° |
| β |
84.399 ± 0.007° |
| γ |
77.252 ± 0.007° |
| Cell volume |
869.32 ± 0.14 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0497 |
| Residual factor for significantly intense reflections |
0.0457 |
| Weighted residual factors for significantly intense reflections |
0.123 |
| Weighted residual factors for all reflections included in the refinement |
0.1292 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239532.html