Information card for entry 2239541
| Chemical name |
2,3-Diphenyl-2,3-dihydro-4<i>H</i>-pyrido[3,2-<i>e</i>][1,3]thiazin-4-one |
| Formula |
C19 H14 N2 O S |
| Calculated formula |
C19 H14 N2 O S |
| SMILES |
C1(=O)c2cccnc2SC(c2ccccc2)N1c1ccccc1 |
| Title of publication |
2,3-Diphenyl-2,3-dihydro-4<i>H</i>-pyrido[3,2-<i>e</i>][1,3]thiazin-4-one |
| Authors of publication |
Yennawar, Hemant P.; Singh, Harnoor; Silverberg, Lee J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
6 |
| Pages of publication |
o638 |
| a |
9.069 ± 0.007 Å |
| b |
9.772 ± 0.007 Å |
| c |
10.15 ± 0.007 Å |
| α |
80.32 ± 0.011° |
| β |
63.737 ± 0.01° |
| γ |
78.591 ± 0.012° |
| Cell volume |
787.4 ± 1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0453 |
| Residual factor for significantly intense reflections |
0.0407 |
| Weighted residual factors for significantly intense reflections |
0.1099 |
| Weighted residual factors for all reflections included in the refinement |
0.1138 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239541.html