Information card for entry 2239592
| Chemical name |
2,3,5,6-Tetrafluoro-1,4-bis({[(5-methylthiophen-2-yl)methylidene]amino}methyl)benzene |
| Formula |
C20 H16 F4 N2 S2 |
| Calculated formula |
C20 H16 F4 N2 S2 |
| SMILES |
Fc1c(C/N=C/c2ccc(s2)C)c(F)c(c(c1F)C/N=C/c1ccc(s1)C)F |
| Title of publication |
2,3,5,6-Tetrafluoro-1,4-bis({[(5-methylthiophen-2-yl)methylidene]amino}methyl)benzene |
| Authors of publication |
Luo, Hai-Kun; Qin, Rui-Rui; He, Ming-Yang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
6 |
| Pages of publication |
o698 |
| a |
9.472 ± 0.002 Å |
| b |
8.8083 ± 0.0019 Å |
| c |
12.335 ± 0.003 Å |
| α |
90° |
| β |
111.459 ± 0.004° |
| γ |
90° |
| Cell volume |
957.8 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0545 |
| Residual factor for significantly intense reflections |
0.0478 |
| Weighted residual factors for significantly intense reflections |
0.1221 |
| Weighted residual factors for all reflections included in the refinement |
0.129 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.059 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239592.html