Information card for entry 2239662
| Chemical name |
(<i>R</i>,<i>S</i>)-2'-Amino-6'-methyl-2,5',5'-trioxo-6'<i>H</i>-spiro[indoline-3,4'-pyrano[3,2-<i>c</i>][2,1]benzothiazine]-3'-carbonitrile dimethylformamide monosolvate |
| Formula |
C23 H21 N5 O5 S |
| Calculated formula |
C23 H21 N5 O5 S |
| SMILES |
S1(=O)(=O)N(c2ccccc2C2=C1C1(C(=O)Nc3c1cccc3)C(=C(O2)N)C#N)C.O=CN(C)C |
| Title of publication |
(<i>R</i>,<i>S</i>)-2'-Amino-6'-methyl-2,5',5'-trioxo-6'<i>H</i>-spiro[indoline-3,4'-pyrano[3,2-<i>c</i>][2,1]benzothiazine]-3'-carbonitrile dimethylformamide monosolvate |
| Authors of publication |
Shishkina, Svitlana V.; Ukrainets, Igor V.; Petrushova, Lidiya A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
7 |
| Pages of publication |
o786 - o787 |
| a |
17.2493 ± 0.0012 Å |
| b |
9.6046 ± 0.0005 Å |
| c |
27.7664 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4600.1 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1483 |
| Residual factor for significantly intense reflections |
0.0717 |
| Weighted residual factors for significantly intense reflections |
0.1661 |
| Weighted residual factors for all reflections included in the refinement |
0.1943 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.993 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239662.html