Information card for entry 2239732
| Chemical name |
3,12-Dimethoxy-5,6,9,10-tetrahydro-[5]helicene-7,8-dicarbonitrile |
| Formula |
C26 H20 N2 O2 |
| Calculated formula |
C26 H20 N2 O2 |
| SMILES |
c1cc(cc2CCc3c(c12)c1c2ccc(cc2CCc1c(c3C#N)C#N)OC)OC |
| Title of publication |
3,12-Dimethoxy-5,6,9,10-tetrahydro-[5]helicene-7,8-dicarbonitrile |
| Authors of publication |
Sahasithiwat, Somboon; Sooksimuang, Thanasat; Kamtonwong, Siriporn; Parnchan, Waraporn; Kangkaew, Laongdao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
8 |
| Pages of publication |
o837 |
| a |
17.9533 ± 0.0007 Å |
| b |
13.5533 ± 0.0007 Å |
| c |
8.1417 ± 0.0004 Å |
| α |
90° |
| β |
95.785 ± 0.002° |
| γ |
90° |
| Cell volume |
1971 ± 0.16 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0584 |
| Residual factor for significantly intense reflections |
0.0421 |
| Weighted residual factors for significantly intense reflections |
0.1171 |
| Weighted residual factors for all reflections included in the refinement |
0.1365 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239732.html