Information card for entry 2239742
| Chemical name |
2,5-Diazido-1,4-phenylene diacetate |
| Formula |
C10 H8 N6 O4 |
| Calculated formula |
C10 H8 N6 O4 |
| SMILES |
c1(cc(c(cc1N=N#N)OC(=O)C)N=N#N)OC(=O)C |
| Title of publication |
Crystal structures of 2,5-diazido-1,4-phenylene diacetate and 2,5-diazido-1,4-phenylene dibutyrate |
| Authors of publication |
Glöcklhofer, Florian; Fröhlich, Johannes; Stöger, Berthold; Weil, Matthias |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
7 |
| Pages of publication |
39 - 42 |
| a |
5.4293 ± 0.0006 Å |
| b |
5.5678 ± 0.0006 Å |
| c |
10.4945 ± 0.0012 Å |
| α |
101.508 ± 0.003° |
| β |
104.544 ± 0.003° |
| γ |
97.057 ± 0.003° |
| Cell volume |
295.86 ± 0.06 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0365 |
| Residual factor for significantly intense reflections |
0.0337 |
| Weighted residual factors for significantly intense reflections |
0.0553 |
| Weighted residual factors for all reflections included in the refinement |
0.0558 |
| Goodness-of-fit parameter for all reflections included in the refinement |
3.22 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239742.html