Information card for entry 2239884
| Chemical name |
<i>N</i>^1^-Benzyl-<i>N</i>^1^,<i>N</i>^2^,<i>N</i>^2^-trimethylethane-1,2-diaminium dichloride |
| Formula |
C12 H22 Cl2 N2 |
| Calculated formula |
C12 H22 Cl2 N2 |
| SMILES |
[Cl-].[Cl-].[NH+](Cc1ccccc1)(C)CC[NH+](C)C |
| Title of publication |
Crystal structure of <i>N</i>^1^-benzyl-<i>N</i>^1^,<i>N</i>^2^,<i>N</i>^2^-trimethylethane-1,2-diaminium dichloride |
| Authors of publication |
Singh, Pushpendra; Singh, Harkesh B.; Butcher, Ray J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
9 |
| Pages of publication |
o911 - o912 |
| a |
5.6744 ± 0.0007 Å |
| b |
22.384 ± 0.003 Å |
| c |
5.9991 ± 0.0007 Å |
| α |
90° |
| β |
105.372 ± 0.012° |
| γ |
90° |
| Cell volume |
734.72 ± 0.16 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.083 |
| Residual factor for significantly intense reflections |
0.0823 |
| Weighted residual factors for significantly intense reflections |
0.2283 |
| Weighted residual factors for all reflections included in the refinement |
0.229 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.125 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239884.html