Information card for entry 2239941
| Common name |
3,5-Bis(4-Chlorophenyl)-1-propyl-1,3,5-triazacyclohexane |
| Chemical name |
3,5-Bis(4-chlorophenyl)-1-propyl-1,3,5-triazacyclohexane |
| Formula |
C18 H21 Cl2 N3 |
| Calculated formula |
C18 H21 Cl2 N3 |
| SMILES |
C1N(CN(CN1c1ccc(cc1)Cl)CCC)c1ccc(cc1)Cl |
| Title of publication |
Crystal structure of 3,5-bis(4-chlorophenyl)-1-propyl-1,3,5-triazacyclohexane |
| Authors of publication |
Lefrada, Leila; Bouchemma, Ahcene; Bouacida, Sofiane; Claiser, Nicolas; Souhassou, Mohamed |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
9 |
| Pages of publication |
o1061 - o1062 |
| a |
6.0785 ± 0.0003 Å |
| b |
10.319 ± 0.0006 Å |
| c |
14.436 ± 0.0008 Å |
| α |
91.57 ± 0.003° |
| β |
91.946 ± 0.002° |
| γ |
99.055 ± 0.003° |
| Cell volume |
893.19 ± 0.08 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0613 |
| Residual factor for significantly intense reflections |
0.0492 |
| Weighted residual factors for significantly intense reflections |
0.1317 |
| Weighted residual factors for all reflections included in the refinement |
0.1418 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239941.html