Information card for entry 2240014
| Chemical name |
4,5-Bis(3,4,5-trimethoxyphenyl)-2<i>H</i>-1,2,3-triazole methanol solvate |
| Formula |
C21 H27 N3 O7 |
| Calculated formula |
C21 H27 N3 O7 |
| SMILES |
n1[nH]nc(c1c1cc(OC)c(OC)c(OC)c1)c1cc(OC)c(OC)c(OC)c1.OC |
| Title of publication |
Crystal structure of 4,5-bis(3,4,5-trimethoxyphenyl)-2<i>H</i>-1,2,3-triazole methanol solvate |
| Authors of publication |
Madadi, Nikhil Reddy; Penthala, Narsimha Reddy; Bommagani, Shobanbabu; Parkin, Sean; Crooks, Peter A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
10 |
| Pages of publication |
o1128 - o1129 |
| a |
10.1458 ± 0.0001 Å |
| b |
10.609 ± 0.0001 Å |
| c |
11.0435 ± 0.0002 Å |
| α |
89.5708 ± 0.0006° |
| β |
72.5903 ± 0.0006° |
| γ |
70.7146 ± 0.0007° |
| Cell volume |
1065.07 ± 0.03 Å3 |
| Cell temperature |
90 ± 0.2 K |
| Ambient diffraction temperature |
90 ± 0.2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0571 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.1178 |
| Weighted residual factors for all reflections included in the refinement |
0.1273 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240014.html