Information card for entry 2240109
| Common name |
Potassium (1<i>R</i>)-<i>D</i>-ribit-1-ylsulfonate |
| Chemical name |
Potassium (1<i>R</i>,2<i>R</i>,3<i>R</i>,4<i>R</i>)-1,2,3,4,5-pentahydroxypentane-1-sulfonate |
| Formula |
C5 H11 K O8 S |
| Calculated formula |
C5 H11 K O8 S |
| SMILES |
[K+].[C@@H]([C@@H]([C@@H]([C@@H](CO)O)O)O)(O)S(=O)(=O)[O-] |
| Title of publication |
Crystal structure of potassium (1<i>R</i>)-<small>D</small>-ribit-1-ylsulfonate |
| Authors of publication |
Haines, Alan H.; Hughes, David L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
11 |
| Pages of publication |
406 - 409 |
| a |
5.36167 ± 0.00008 Å |
| b |
9.01474 ± 0.00014 Å |
| c |
9.78623 ± 0.00017 Å |
| α |
90° |
| β |
102.814 ± 0.0016° |
| γ |
90° |
| Cell volume |
461.228 ± 0.013 Å3 |
| Cell temperature |
140 ± 2 K |
| Ambient diffraction temperature |
140 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0215 |
| Residual factor for significantly intense reflections |
0.0207 |
| Weighted residual factors for significantly intense reflections |
0.052 |
| Weighted residual factors for all reflections included in the refinement |
0.0525 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
Mo-Kα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240109.html