Information card for entry 2240235
| Chemical name |
Tetraaqua(5,5'-dimethyl-2,2'-bipyridyl-κ^2^<i>N</i>,<i>N</i>')iron(II) sulfate |
| Formula |
C12 H20 Fe N2 O8 S |
| Calculated formula |
C12 H20 Fe N2 O8 S |
| SMILES |
[Fe]1([n]2c(c3[n]1cc(cc3)C)ccc(c2)C)([OH2])([OH2])([OH2])[OH2].S(=O)(=O)([O-])[O-] |
| Title of publication |
Crystal structure of tetraaqua(5,5'-dimethyl-2,2'-bipyridyl-κ^2^<i>N</i>,<i>N</i>')iron(II) sulfate |
| Authors of publication |
Belamri, Yamine; Setifi, Fatima; Francuski, Bojana M.; Novaković, Sladjana B.; Zouaoui, Setifi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
12 |
| Pages of publication |
544 - 546 |
| a |
9.579 ± 0.0007 Å |
| b |
9.619 ± 0.0009 Å |
| c |
18.55 ± 0.0012 Å |
| α |
90° |
| β |
101.527 ± 0.005° |
| γ |
90° |
| Cell volume |
1674.7 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0958 |
| Residual factor for significantly intense reflections |
0.0654 |
| Weighted residual factors for significantly intense reflections |
0.183 |
| Weighted residual factors for all reflections included in the refinement |
0.1957 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240235.html