Information card for entry 2240648
| Common name |
(E,E)-thiene-2,5-diylbis[N-(4-methylphenyl)methanimine] |
| Chemical name |
<i>N</i>,<i>N</i>'-[(Thiophene-2,5-diyl)bis(methanylylidene)]di-<i>p</i>-toluidine |
| Formula |
C20 H18 N2 S |
| Calculated formula |
C20 H18 N2 S |
| SMILES |
s1c(ccc1/C=N/c1ccc(cc1)C)/C=N/c1ccc(cc1)C |
| Title of publication |
Crystal structure of <i>N</i>,<i>N</i>'-[(thiophene-2,5-diyl)bis(methanylylidene)]di-<i>p</i>-toluidine |
| Authors of publication |
Boyle, Raina; Crundwell, Guy; Glagovich, Neil M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
6 |
| Pages of publication |
o403 |
| a |
37.166 ± 0.002 Å |
| b |
6.0292 ± 0.0002 Å |
| c |
7.5814 ± 0.0004 Å |
| α |
90° |
| β |
93.452 ± 0.007° |
| γ |
90° |
| Cell volume |
1695.77 ± 0.14 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0662 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.1295 |
| Weighted residual factors for all reflections included in the refinement |
0.1445 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240648.html