Information card for entry 2240722
| Chemical name |
1-Ethylspiro[imidazolidine-4,1'-indane]-2,5-dione |
| Formula |
C13 H14 N2 O2 |
| Calculated formula |
C13 H14 N2 O2 |
| SMILES |
O=C1N(C(=O)NC21c1ccccc1CC2)CC |
| Title of publication |
Crystal structure of 1-ethylspiro[imidazolidine-4,1'-indane]-2,5-dione |
| Authors of publication |
Hussein, Wahraan Mohammed; Theodore, Cynthia E.; Benaka Prasad, S. B.; Madaiah, M.; Naveen, S.; Lokanath, N. K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
9 |
| Pages of publication |
o954 |
| a |
13.7183 ± 0.001 Å |
| b |
6.204 ± 0.0005 Å |
| c |
15.1944 ± 0.0011 Å |
| α |
90° |
| β |
112.865 ± 0.003° |
| γ |
90° |
| Cell volume |
1191.56 ± 0.16 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0462 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.1161 |
| Weighted residual factors for all reflections included in the refinement |
0.1197 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240722.html