Information card for entry 2240740
| Chemical name |
2-(4-Fluorophenyl)-4-(thiophen-2-yl)-2,3-dihydro-1,5-benzothiazepine |
| Formula |
C19 H14 F N S2 |
| Calculated formula |
C19 H14 F N S2 |
| SMILES |
S1C(CC(=Nc2c1cccc2)c1sccc1)c1ccc(F)cc1 |
| Title of publication |
2-(4-Fluorophenyl)-4-(thiophen-2-yl)-2,3-dihydro-1,5-benzothiazepine |
| Authors of publication |
Manjula, M.; Manjunath, B. C.; Renuka, N.; Ajay Kumar, K.; Lokanath, N. K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
11 |
| Pages of publication |
o1608 |
| a |
26.1463 ± 0.0017 Å |
| b |
12.3091 ± 0.0008 Å |
| c |
10.1776 ± 0.0007 Å |
| α |
90° |
| β |
101.383 ± 0.004° |
| γ |
90° |
| Cell volume |
3211.1 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0625 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1239 |
| Weighted residual factors for all reflections included in the refinement |
0.1341 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240740.html