Information card for entry 2240866
| Chemical name |
1,4-Diethoxy-9,10-anthraquinone |
| Formula |
C18 H16 O4 |
| Calculated formula |
C18 H16 O4 |
| SMILES |
c1(ccc(c2C(=O)c3ccccc3C(=O)c12)OCC)OCC |
| Title of publication |
Crystal structure of 1,4-diethoxy-9,10-anthraquinone |
| Authors of publication |
Kitamura, Chitoshi; Li, Sining; Takehara, Munenori; Inoue, Yoshinori; Ono, Katsuhiko; Kawase, Takeshi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
7 |
| Pages of publication |
o504 - o505 |
| a |
13.5514 ± 0.0011 Å |
| b |
14.7204 ± 0.0011 Å |
| c |
14.5905 ± 0.001 Å |
| α |
90° |
| β |
90.604 ± 0.003° |
| γ |
90° |
| Cell volume |
2910.4 ± 0.4 Å3 |
| Cell temperature |
223 K |
| Ambient diffraction temperature |
223 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1239 |
| Residual factor for significantly intense reflections |
0.0761 |
| Weighted residual factors for significantly intense reflections |
0.2024 |
| Weighted residual factors for all reflections included in the refinement |
0.2726 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.933 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240866.html