Information card for entry 2240955
| Chemical name |
13-(2-Methoxyphenyl)-3,4-dihydro-2<i>H</i>-indazolo[1,2-<i>b</i>]phthalazine-1,6,11(13<i>H</i>)-trione |
| Formula |
C22 H18 N2 O4 |
| Calculated formula |
C22 H18 N2 O4 |
| SMILES |
C1(=O)c2ccccc2C(=O)N2C(C3=C(CCCC3=O)N12)c1ccccc1OC |
| Title of publication |
Crystal structure of 13-(2-methoxyphenyl)-3,4-dihydro-2<i>H</i>-indazolo[1,2-<i>b</i>]phthalazine-1,6,11(13<i>H</i>)-trione |
| Authors of publication |
Bouraiou, Abdelmalek; Bouacida, Sofiane; Merazig, Hocine; Chibani, Aissa; Bouaziz, Zouhair |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
8 |
| Pages of publication |
o604 - o605 |
| a |
8.5839 ± 0.0002 Å |
| b |
11.8474 ± 0.0002 Å |
| c |
17.5317 ± 0.0004 Å |
| α |
90° |
| β |
102.199 ± 0.001° |
| γ |
90° |
| Cell volume |
1742.66 ± 0.06 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0752 |
| Residual factor for significantly intense reflections |
0.0562 |
| Weighted residual factors for significantly intense reflections |
0.1461 |
| Weighted residual factors for all reflections included in the refinement |
0.1632 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240955.html