Information card for entry 2241198
| Chemical name |
2,4,6-Tris(cyclohexyloxy)-1,3,5-triazine |
| Formula |
C21 H33 N3 O3 |
| Calculated formula |
C21 H33 N3 O3 |
| SMILES |
c1(nc(nc(n1)OC1CCCCC1)OC1CCCCC1)OC1CCCCC1 |
| Title of publication |
Crystal structure of 2,4,6-tris(cyclohexyloxy)-1,3,5-triazine |
| Authors of publication |
Sankolli, Ravish; Hauser, Jürg; Row, T. N. Guru; Hulliger, Jürg |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
11 |
| Pages of publication |
1328 - 1331 |
| a |
9.702 ± 0.0002 Å |
| b |
10.1456 ± 0.0003 Å |
| c |
11.2064 ± 0.0003 Å |
| α |
96.528 ± 0.002° |
| β |
95.982 ± 0.002° |
| γ |
112.11 ± 0.002° |
| Cell volume |
1002.3 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0578 |
| Residual factor for significantly intense reflections |
0.0517 |
| Weighted residual factors for significantly intense reflections |
0.1362 |
| Weighted residual factors for all reflections included in the refinement |
0.1415 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.043 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241198.html
