Information card for entry 2241248
| Chemical name |
Bis[<i>N</i>,<i>N</i>-bis(2-hydroxyethyl)glycinato-κ^3^<i>O</i>^1^,<i>N</i>,<i>O</i>^2^]cobalt(II) monohydrate |
| Formula |
C12 H26 Co N2 O9 |
| Calculated formula |
C12 H26 Co N2 O9 |
| SMILES |
C1(=O)C[N]2(CC[OH][Co]342([N](CC(=O)O3)(CCO)CC[OH]4)O1)CCO.O |
| Title of publication |
Crystal structure of bis[<i>N</i>,<i>N</i>-bis(2-hydroxyethyl)glycinato-κ^3^<i>O</i>^1^,<i>N</i>,<i>O</i>^2^]cobalt(II) monohydrate |
| Authors of publication |
Liu, Yang; Zhou, Dan; Liu, Hai-Hui; He, Chen-Cong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
11 |
| Pages of publication |
m199 - m200 |
| a |
19.274 ± 0.003 Å |
| b |
12.0033 ± 0.0017 Å |
| c |
7.196 ± 0.001 Å |
| α |
90° |
| β |
100.081 ± 0.002° |
| γ |
90° |
| Cell volume |
1639.1 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.0367 |
| Weighted residual factors for significantly intense reflections |
0.0991 |
| Weighted residual factors for all reflections included in the refinement |
0.1082 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241248.html