Information card for entry 2241346
| Chemical name |
(<i>E</i>)-3-(4-Hydroxybenzyl)-4-{[4-(methylsulfanyl)benzylidene]amino}-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C17 H16 N4 O S2 |
| Calculated formula |
C17 H16 N4 O S2 |
| SMILES |
S=C1NN=C(N1/N=C/c1ccc(SC)cc1)Cc1ccc(O)cc1 |
| Title of publication |
Crystal structure of (<i>E</i>)-5-(4-hydroxybenzyl)-4-{[4-(methylsulfanyl)benzylidene]amino}-2,4-dihydro-3<i>H</i>-1,2,4-triazole-3-thione |
| Authors of publication |
Manjula, P. S.; Sarojini, B. K.; Narayana, B.; Byrappa, K.; Madan Kumar, S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
12 |
| Pages of publication |
o982 - o983 |
| a |
7.739 ± 0.005 Å |
| b |
28.161 ± 0.016 Å |
| c |
7.945 ± 0.004 Å |
| α |
90° |
| β |
100.407 ± 0.011° |
| γ |
90° |
| Cell volume |
1703 ± 1.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293.15 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.072 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.0971 |
| Weighted residual factors for all reflections included in the refinement |
0.1074 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241346.html