Information card for entry 2243242
| Chemical name |
3-(Adamantan-1-yl)-4-(2-bromo-4-fluorophenyl)-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C18 H19 Br F N3 S |
| Calculated formula |
C18 H19 Br F N3 S |
| SMILES |
Brc1c(N2C(=S)NN=C2C23CC4CC(C2)CC(C3)C4)ccc(F)c1 |
| Title of publication |
Synthesis and crystal structure of 3-(adamantan-1-yl)-4-(2-bromo-4-fluorophenyl)-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
Abdelrazeq, Alaa S.; Ghabbour, Hazem A.; El-Emam, Ali A.; Osman, Doaa Ahmed; Garcia-Granda, Santiago |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
2 |
| Pages of publication |
162 - 166 |
| a |
6.8473 ± 0.0001 Å |
| b |
12.5587 ± 0.0002 Å |
| c |
19.809 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1703.44 ± 0.04 Å3 |
| Cell temperature |
150.6 ± 0.9 K |
| Ambient diffraction temperature |
150.6 ± 0.9 K |
| Number of distinct elements |
6 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0412 |
| Residual factor for significantly intense reflections |
0.0347 |
| Weighted residual factors for significantly intense reflections |
0.0776 |
| Weighted residual factors for all reflections included in the refinement |
0.0812 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243242.html