Information card for entry 2243253
| Chemical name |
4-(3,4-Dimethylanilino)-<i>N</i>-(3,4-dimethylphenyl)quinoline-3-carboxamide |
| Formula |
C26 H25 N3 O |
| Calculated formula |
C26 H25 N3 O |
| SMILES |
O=C(Nc1cc(c(cc1)C)C)c1cnc2c(c1Nc1cc(c(cc1)C)C)cccc2 |
| Title of publication |
The synthesis, crystal structure and Hirshfeld analysis of 4-(3,4-dimethylanilino)-<i>N</i>-(3,4-dimethylphenyl)quinoline-3-carboxamide |
| Authors of publication |
Gomes, Ligia R.; Low, John Nicolson; Borges, Fernanda; Gaspar, Alexandra; Mesiti, Francesco |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
2 |
| Pages of publication |
201 - 207 |
| a |
6.2502 ± 0.0003 Å |
| b |
15.7915 ± 0.0006 Å |
| c |
20.7395 ± 0.0009 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2046.99 ± 0.15 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0513 |
| Residual factor for significantly intense reflections |
0.0442 |
| Weighted residual factors for significantly intense reflections |
0.0915 |
| Weighted residual factors for all reflections included in the refinement |
0.0939 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243253.html