Information card for entry 2243513
| Chemical name |
1,4-Dibenzyl-6-methyl-1,4-dihydroquinoxaline-2,3-dione |
| Formula |
C23 H20 N2 O2 |
| Calculated formula |
C23 H20 N2 O2 |
| SMILES |
O=C1N(c2c(cc(cc2)C)N(C1=O)Cc1ccccc1)Cc1ccccc1 |
| Title of publication |
Synthesis, crystal structures and Hirshfeld surface analysis of 1,4-dibenzyl-6-methyl-1,4-dihydroquinoxaline-2,3-dione |
| Authors of publication |
Cinar, Emine Berrin; Zouitini, Ayman; Kandri Rodi, Youssef; Ouzidan, Younes; Marrot, Jérôme; Prim, Damien; Dege, Necmi; Saif, Eiad |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2020 |
| Journal volume |
76 |
| Journal issue |
8 |
| Pages of publication |
1361 - 1364 |
| a |
9.0844 ± 0.0012 Å |
| b |
18.7227 ± 0.0018 Å |
| c |
11.2708 ± 0.0014 Å |
| α |
90° |
| β |
104.848 ± 0.004° |
| γ |
90° |
| Cell volume |
1853 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1097 |
| Residual factor for significantly intense reflections |
0.0601 |
| Weighted residual factors for significantly intense reflections |
0.1584 |
| Weighted residual factors for all reflections included in the refinement |
0.1876 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2243513.html