Information card for entry 2312422
| Chemical name |
4-(4-Chlorophenyl)-3-(pyridin-2-yl)-5-(pyrimidin-2-yl)-1,2,4-triazole |
| Formula |
C17 H11 Cl N6 |
| Calculated formula |
C17 H11 Cl N6 |
| SMILES |
Clc1ccc(n2c(nnc2c2ncccn2)c2ncccc2)cc1 |
| Title of publication |
Syntheses, crystal structures and intermolecular interactions of six novel pyrimidin-2-yl-substituted triaryltriazoles. |
| Authors of publication |
Song, Huijie; Peng, Ri; Zuo, Yi; Wang, Tao; Zhu, Dunru |
| Journal of publication |
Acta crystallographica. Section C, Structural chemistry |
| Year of publication |
2024 |
| Journal volume |
80 |
| Journal issue |
4 |
| a |
8.5105 ± 0.0013 Å |
| b |
9.3681 ± 0.0014 Å |
| c |
10.8959 ± 0.0016 Å |
| α |
81.355 ± 0.002° |
| β |
82.482 ± 0.002° |
| γ |
67.388 ± 0.002° |
| Cell volume |
790.3 ± 0.2 Å3 |
| Cell temperature |
293.15 K |
| Ambient diffraction temperature |
293.15 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0456 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.0984 |
| Weighted residual factors for all reflections included in the refinement |
0.1021 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2312422.html