Information card for entry 4001716
| Formula |
C48 H50 N2 O2 S4 |
| Calculated formula |
C48 H50 N2 O2 S4 |
| SMILES |
CCCCC(CN1C(=O)/C(=C/2C=C(N(C2=O)CC(CCCC)CC)c2ccc(s2)c2cc3c(s2)cccc3)C=C1c1ccc(s1)c1cc2c(s1)cccc2)CC |
| Title of publication |
New Donor–Acceptor–Donor Molecules with Pechmann Dye as the Core Moiety for Solution-Processed Good-Performance Organic Field-Effect Transistors |
| Authors of publication |
Cai, Zhengxu; Guo, Yunlong; Yang, Sifen; Peng, Qian; Luo, Hewei; Liu, Zitong; Zhang, Guanxin; Liu, Yunqi; Zhang, Deqing |
| Journal of publication |
Chemistry of Materials |
| Year of publication |
2013 |
| Journal volume |
25 |
| Journal issue |
3 |
| Pages of publication |
471 |
| a |
9.629 ± 0.0019 Å |
| b |
9.9 ± 0.002 Å |
| c |
12.559 ± 0.003 Å |
| α |
74.57 ± 0.03° |
| β |
84.4 ± 0.03° |
| γ |
62.82 ± 0.03° |
| Cell volume |
1026.2 ± 0.5 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1088 |
| Residual factor for significantly intense reflections |
0.0891 |
| Weighted residual factors for significantly intense reflections |
0.2173 |
| Weighted residual factors for all reflections included in the refinement |
0.2348 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.112 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4001716.html