Information card for entry 4031934
| Formula |
C9 H14 O3 |
| Calculated formula |
C9 H14 O3 |
| SMILES |
O=C(C)[C@@]1([C@@](O)(C(=O)CC1)C)C.O=C(C)[C@]1([C@](O)(C(=O)CC1)C)C |
| Title of publication |
Asymmetric Desymmetrization of 1,3-Diketones via Intramolecular Benzoin Reaction. |
| Authors of publication |
Li, Yuanzhen; Yang, Shuang; Wen, Genfa; Lin, Qiqiao; Zhang, Guoxiang; Qiu, Lin; Zhang, Xiaoyan; Du, Guangfen; Fang, Xinqiang |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2016 |
| Journal volume |
81 |
| Journal issue |
7 |
| Pages of publication |
2763 - 2769 |
| a |
6.1436 ± 0.0004 Å |
| b |
6.8104 ± 0.0006 Å |
| c |
10.8156 ± 0.0009 Å |
| α |
87.661 ± 0.007° |
| β |
78.156 ± 0.007° |
| γ |
83.52 ± 0.006° |
| Cell volume |
439.99 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.042 |
| Residual factor for significantly intense reflections |
0.0374 |
| Weighted residual factors for significantly intense reflections |
0.1009 |
| Weighted residual factors for all reflections included in the refinement |
0.1045 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.088 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4031934.html