Information card for entry 4032481
| Chemical name |
4-methyl-7-(4-hydroxyphenyl)-2H-[1,2,4]triazolo[3,2-c] [1,2,4]triazole |
| Formula |
C10 H9 N5 O |
| Calculated formula |
C10 H9 N5 O |
| SMILES |
c1(ccc(cc1)c1n[nH]c2nc(C)nn12)O |
| Title of publication |
Solid State Separation and Isolation of Tautomers of Fused-Ring Triazolotriazoles. |
| Authors of publication |
Centore, Roberto; Manfredi, Carla; Capobianco, Amedeo; Volino, Sabato; Ferrara, Maria Vittoria; Carella, Antonio; Fusco, Sandra; Peluso, Andrea |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2017 |
| a |
10.062 ± 0.005 Å |
| b |
7.286 ± 0.003 Å |
| c |
27.054 ± 0.006 Å |
| α |
90° |
| β |
105.89 ± 0.02° |
| γ |
90° |
| Cell volume |
1907.6 ± 1.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1355 |
| Residual factor for significantly intense reflections |
0.0574 |
| Weighted residual factors for significantly intense reflections |
0.0992 |
| Weighted residual factors for all reflections included in the refinement |
0.121 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4032481.html