Information card for entry 4032486
| Formula |
C16 H14 N2 O3 |
| Calculated formula |
C16 H14 N2 O3 |
| SMILES |
O(c1c(OC)cc2c3n4c(cccc4cn3)c2c1OC)C |
| Title of publication |
General C-H Arylation Strategy for the Synthesis of Tunable Visible Light-Emitting Benzo[a]imidazo[2,1,5-c,d]indolizine Fluorophores. |
| Authors of publication |
Lévesque, Éric; Bechara, William S.; Constantineau-Forget, Léa; Pelletier, Guillaume; Rachel, Natalie M.; Pelletier, Joelle N.; Charette, André B |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2017 |
| Journal volume |
82 |
| Journal issue |
10 |
| Pages of publication |
5046 - 5067 |
| a |
10.4971 ± 0.0002 Å |
| b |
7.6333 ± 0.0001 Å |
| c |
16.6642 ± 0.0003 Å |
| α |
90° |
| β |
93.33 ± 0.001° |
| γ |
90° |
| Cell volume |
1333.01 ± 0.04 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0348 |
| Residual factor for significantly intense reflections |
0.0325 |
| Weighted residual factors for significantly intense reflections |
0.0886 |
| Weighted residual factors for all reflections included in the refinement |
0.0916 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4032486.html