Information card for entry 4032999
| Formula |
C16 H9 Cl3 N2 O |
| Calculated formula |
C16 H9 Cl3 N2 O |
| SMILES |
Clc1c(C(=O)n2c(ncc2)c2ccccc2)c(Cl)cc(Cl)c1 |
| Title of publication |
Elucidation of the E-Amide Preference of N-Acyl Azoles. |
| Authors of publication |
Takahashi, Yuka; Ikeda, Hirotaka; Kanase, Yuki; Makino, Kosho; Tabata, Hidetsugu; Oshitari, Tetsuta; Inagaki, Satoshi; Otani, Yuko; Natsugari, Hideaki; Takahashi, Hideyo; Ohwada, Tomohiko |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2017 |
| Journal volume |
82 |
| Journal issue |
21 |
| Pages of publication |
11370 - 11382 |
| a |
8.1387 ± 0.0003 Å |
| b |
9.4496 ± 0.0003 Å |
| c |
20.2855 ± 0.0008 Å |
| α |
90° |
| β |
101.92 ± 0.002° |
| γ |
90° |
| Cell volume |
1526.47 ± 0.1 Å3 |
| Cell temperature |
173 K |
| Ambient diffraction temperature |
173 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1377 |
| Residual factor for significantly intense reflections |
0.0737 |
| Weighted residual factors for significantly intense reflections |
0.1379 |
| Weighted residual factors for all reflections included in the refinement |
0.1931 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.073 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4032999.html