Information card for entry 4036091
| Formula |
C98 H124 Cl6 N2 O12 |
| Calculated formula |
C98 H124 Cl6 N2 O12 |
| SMILES |
C(Cl)(Cl)Cl.C(Cl)(Cl)Cl.O=C1N(C(=O)c2c3c1c(cc1c3c(cc2c2c(OC)cccc2OC)c2c3c1cc(c1c3c(c(c2)c2c(OC)cccc2OC)C(=O)N(C1=O)C[C@@H](CCCCCCCCCC)CCCCCCCC)c1c(OC)cccc1OC)c1c(OC)cccc1OC)C[C@H](CCCCCCCCCC)CCCCCCCC |
| Title of publication |
Doubly Encapsulated Perylene Diimides: Effect of Molecular Encapsulation on Photophysical Properties. |
| Authors of publication |
Royakkers, Jeroen; Minotto, Alessandro; Congrave, Daniel G.; Zeng, Weixuan; Patel, Adil; Bond, Andrew D.; Bučar, Dejan-Krešimir; Cacialli, Franco; Bronstein, Hugo |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2019 |
| a |
16.5071 ± 0.0007 Å |
| b |
12.026 ± 0.0005 Å |
| c |
47.761 ± 0.002 Å |
| α |
90° |
| β |
98.26 ± 0.003° |
| γ |
90° |
| Cell volume |
9382.9 ± 0.7 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.2786 |
| Residual factor for significantly intense reflections |
0.1678 |
| Weighted residual factors for significantly intense reflections |
0.4148 |
| Weighted residual factors for all reflections included in the refinement |
0.4726 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.337 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4036091.html