Information card for entry 4036111
| Formula |
C28 H26 Br2 N6 |
| Calculated formula |
C28 H26 Br2 N6 |
| SMILES |
Brc1n(nnc1c1cc(ccc1)c1nnn(c1Br)c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C |
| Title of publication |
Anion receptors based on halogen bonding with halo-1,2,3-triazoliums. |
| Authors of publication |
Tepper, Ronny; Schulze, Benjamin; Jäger, Michael; Friebe, Christian; Scharf, Daniel H.; Görls, Helmar; Schubert, Ulrich S. |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2015 |
| Journal volume |
80 |
| Journal issue |
6 |
| Pages of publication |
3139 - 3150 |
| a |
43.4863 ± 0.0009 Å |
| b |
7.3787 ± 0.0001 Å |
| c |
16.9153 ± 0.0003 Å |
| α |
90° |
| β |
106.333 ± 0.001° |
| γ |
90° |
| Cell volume |
5208.61 ± 0.16 Å3 |
| Cell temperature |
133 ± 2 K |
| Ambient diffraction temperature |
133 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0381 |
| Residual factor for significantly intense reflections |
0.0303 |
| Weighted residual factors for significantly intense reflections |
0.067 |
| Weighted residual factors for all reflections included in the refinement |
0.0711 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.071 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4036111.html