Information card for entry 4038732
| Formula |
C24 H36 N5 P |
| Calculated formula |
C24 H36 N5 P |
| SMILES |
P(N1CN(CCC1)c1ccccc1)(=N/N=N/c1ccccc1)(C(C)(C)C)C(C)(C)C |
| Title of publication |
Ring Enlargement of <i>N</i>-Phosphanyl-1,2,3,4-tetrahydroquinazolines. |
| Authors of publication |
Marchenko, Anatoliy; Koidan, Georgyi; Hurieva, Anastasiia N.; Shishkina, Svitlana; Rusanov, Eduard; Kostyuk, Aleksandr |
| Journal of publication |
The Journal of organic chemistry |
| Year of publication |
2020 |
| a |
11.7479 ± 0.0004 Å |
| b |
13.1447 ± 0.0004 Å |
| c |
16.1419 ± 0.0006 Å |
| α |
90° |
| β |
108.509 ± 0.004° |
| γ |
90° |
| Cell volume |
2363.74 ± 0.15 Å3 |
| Cell temperature |
294 K |
| Ambient diffraction temperature |
294 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0672 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.1147 |
| Weighted residual factors for all reflections included in the refinement |
0.1238 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4038732.html