Information card for entry 4064515
| Formula |
C56 H48 Br2 N2 Ni |
| Calculated formula |
C56 H48 Br2 N2 Ni |
| SMILES |
Br[Ni]1([N](=C2C(c3cccc4c3c2ccc4)=[N]1c1c(cc(cc1CC)C)CC)c1c(cc(cc1C(c1ccccc1)c1ccccc1)C)C(c1ccccc1)c1ccccc1)Br |
| Title of publication |
2,6-Dibenzhydryl-N-(2-phenyliminoacenaphthylenylidene)-4-methylbenzenamine Nickel Dibromides: Synthesis, Characterization, and Ethylene Polymerization |
| Authors of publication |
Liu, Hao; Zhao, Weizhen; Hao, Xiang; Redshaw, Carl; Huang, Wei; Sun, Wen-Hua |
| Journal of publication |
Organometallics |
| Year of publication |
2011 |
| Journal volume |
30 |
| Journal issue |
8 |
| Pages of publication |
2418 |
| a |
10.685 ± 0.002 Å |
| b |
12.489 ± 0.003 Å |
| c |
18.069 ± 0.004 Å |
| α |
75.13 ± 0.03° |
| β |
84.45 ± 0.03° |
| γ |
79.63 ± 0.03° |
| Cell volume |
2289.2 ± 0.9 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0631 |
| Residual factor for significantly intense reflections |
0.0516 |
| Weighted residual factors for significantly intense reflections |
0.1375 |
| Weighted residual factors for all reflections included in the refinement |
0.1516 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.211 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4064515.html
