Information card for entry 4064676
| Formula |
C40 H26 Ge S2 |
| Calculated formula |
C40 H26 Ge S2 |
| SMILES |
[Ge]1(C(=C(C(=C1c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)(C#Cc1ccsc1)C#Cc1cscc1 |
| Title of publication |
Synthesis, Characterization, and Crystal Structures of 1,1-Disubstituted-2,3,4,5-tetraphenylgermoles That Exhibit Aggregation-Induced Emission |
| Authors of publication |
Bandrowsky, Teresa L.; Carroll, James B.; Braddock-Wilking, Janet |
| Journal of publication |
Organometallics |
| Year of publication |
2011 |
| Journal volume |
30 |
| Journal issue |
13 |
| Pages of publication |
3559 |
| a |
9.4478 ± 0.0001 Å |
| b |
18.0622 ± 0.0002 Å |
| c |
18.7168 ± 0.0002 Å |
| α |
90° |
| β |
101.252 ± 0.001° |
| γ |
90° |
| Cell volume |
3132.59 ± 0.06 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0471 |
| Residual factor for significantly intense reflections |
0.0414 |
| Weighted residual factors for all reflections |
0.127 |
| Weighted residual factors for significantly intense reflections |
0.118 |
| Weighted residual factors for all reflections included in the refinement |
0.1269 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9499 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4064676.html
