Information card for entry 4064689
| Formula |
C38 H52 F6 N3 P |
| Calculated formula |
C38 H52 F6 N3 P |
| SMILES |
n1n(cc([n+]1c1c(cccc1C(C)C)C(C)C)c1c(cccc1C(C)C)C(C)C)c1c(cccc1C(C)C)C(C)C.[P](F)(F)(F)(F)(F)[F-] |
| Title of publication |
Synthesis of Highly Stable 1,3-Diaryl-1H-1,2,3-triazol-5-ylidenes and their Applications in Ruthenium-Catalyzed Olefin Metathesis. |
| Authors of publication |
Bouffard, Jean; Keitz, Benjamin K.; Tonner, Ralf; Lavallo, Vincent; Guisado-Barrios, Gregorio; Frenking, Gernot; Grubbs, Robert H.; Bertrand, Guy |
| Journal of publication |
Organometallics |
| Year of publication |
2011 |
| Journal volume |
30 |
| Journal issue |
9 |
| Pages of publication |
2617 - 2627 |
| a |
23.7833 ± 0.0013 Å |
| b |
10.6348 ± 0.0006 Å |
| c |
30.7611 ± 0.0017 Å |
| α |
90° |
| β |
100.488 ± 0.001° |
| γ |
90° |
| Cell volume |
7650.4 ± 0.7 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0629 |
| Residual factor for significantly intense reflections |
0.048 |
| Weighted residual factors for significantly intense reflections |
0.1247 |
| Weighted residual factors for all reflections included in the refinement |
0.1363 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/4064689.html